BD3422845
(S)-2-Amino-4-(methylsulfonyl)butanoicacid , 98% , 7314-32-1
Synonym(s):
L -2-Amino-4-(methylsulfonyl)butanoic acid
CAS NO.:7314-32-1
Empirical Formula: C5H11NO4S
Molecular Weight: 181.21
MDL number: MFCD00066020
EINECS: 230-774-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB41.60 | In Stock |
|
| 1g | RMB94.40 | In Stock |
|
| 5g | RMB332.00 | In Stock |
|
| 25g | RMB1129.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~275 °C (dec.) |
| Boiling point: | 450.5±40.0 °C(Predicted) |
| Density | 1.385±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Sparingly), Water (Sparingly, Heated, Sonicated) |
| pka | 2.10±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| BRN | 1725510 |
| Major Application | detection peptide synthesis |
| InChI | 1S/C5H11NO4S/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | UCUNFLYVYCGDHP-BYPYZUCNSA-N |
| SMILES | CS(=O)(=O)CC[C@H](N)C(O)=O |
| CAS DataBase Reference | 7314-32-1(CAS DataBase Reference) |
Description and Uses
L-Methionine Sulfone is an impurity of L-Methionine (M260440) which is an essential aminoacid for human development. L-Methionine is a hepatoprotectant, an antidote (acetominophen poisoning) and a urinary acidifier.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |







