BD3430845
2-Chloro-5-nitrobenzoylchloride , 95% , 25784-91-2
CAS NO.：25784-91-2
Empirical Formula: C7H3Cl2NO3
Molecular Weight: 220.01
MDL number: MFCD00059180
EINECS: 247-262-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB104.00 | In Stock |
|
| 25g | RMB297.60 | In Stock |
|
| 100g | RMB1169.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60°C |
| Boiling point: | 157-158°C 11mm |
| Density | 1.575±0.06 g/cm3(Predicted) |
| Flash point: | 157-158°C/11mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Moisture Sensitive |
| BRN | 2213721 |
| InChI | InChI=1S/C7H3Cl2NO3/c8-6-2-1-4(10(12)13)3-5(6)7(9)11/h1-3H |
| InChIKey | OGLKKYALUKXVPQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC([N+]([O-])=O)=CC=C1Cl |
| CAS DataBase Reference | 25784-91-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-5-nitrobenzoyl chloride(25784-91-2) |
| EPA Substance Registry System | Benzoyl chloride, 2-chloro-5-nitro- (25784-91-2) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-41 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| TSCA | T |
| HS Code | 2916.39.7900 |
| HazardClass | 8 |
| PackingGroup | II |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
