BD3432745
1-(4-Aminophenyl)-1H-pyrrole-2,5-dione , 93% , 29753-26-2
CAS NO.:29753-26-2
Empirical Formula: C10H8N2O2
Molecular Weight: 188.18
MDL number: MFCD00051191
EINECS: 249-824-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB284.00 | In Stock |
|
| 250mg | RMB425.60 | In Stock |
|
| 1g | RMB1064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173 °C |
| Boiling point: | 401.0±28.0 °C(Predicted) |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to crystal |
| pka | 3.70±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C10H8N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6H,11H2 |
| InChIKey | XOPCHXSYQHXLHJ-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(N)C=C2)C(=O)C=CC1=O |
| CAS DataBase Reference | 29753-26-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2925199590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






