BD3434245
Fmoc-Asp(OMpe)-OH , 97% , 180675-08-5
Synonym(s):
Fmoc-Asp(OMpe)-OH;N-α-Fmoc-(O-3-methyl-pent-3-yl)aspartic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB48.80 | In Stock |
|
| 250mg | RMB102.40 | In Stock |
|
| 1g | RMB240.80 | In Stock |
|
| 5g | RMB677.60 | In Stock |
|
| 10g | RMB1066.40 | In Stock |
|
| 25g | RMB2590.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 635.9±55.0 °C(Predicted) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | Store at -15°C to -25°C. |
| pka | 3.56±0.23(Predicted) |
| form | Solid |
| Appearance | White to off-white Solid |
| optical activity | 29°(C=0.01g/ml CHCL3) |
| Major Application | peptide synthesis |
| InChIKey | SYGKUYKLHYQKPL-NRFANRHFSA-N |
| SMILES | C(O)(=O)[C@H](CC(OC(CC)(C)CC)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
The side chain protecting group Mpe in Fmoc-Asp(OMpe)-OH is a more bulky group than the standard tert-Butyl (tBu) group, which significantly helps suppressing the notorious side reaction of aspartimide formation, and thus improve the purity of the crude peptide and facility the time- and cost-intensive purification as well.
FMOC-ASP(OMPE)-OH can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 2 |
| Storage Class | 11 - Combustible Solids |







