BD9537747
Fmoc-Asp(2-phenylisopropylester)-OH , 97% , 200336-86-3
Synonym(s):
Fmoc-Asp(O-2-PhiPr)-OH;N-α-Fmoc-L-aspartic acid β-2-phenylisopropyl ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB460.00 | In Stock |
|
| 250mg | RMB781.60 | In Stock |
|
| 1g | RMB1953.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 687.3±55.0 °C(Predicted) |
| Density | 1.266±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | powder |
| pka | 3.48±0.23(Predicted) |
| Major Application | peptide synthesis |
| InChIKey | MEAHCBOPNIDLFH-DEOSSOPVSA-N |
| SMILES | N([C@@H](CC(=O)OC(C)(C)c4ccccc4)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
Description and Uses
An aspartic acid derivative allowing specific side chain deprotection with 1% TFA in dichloromethane.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 2 water endangering |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |







