BD3450845
1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylicacid , 98% , 5932-32-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB191.20 | In Stock |
|
| 1g | RMB429.60 | In Stock |
|
| 5g | RMB1531.20 | In Stock |
|
| 10g | RMB2760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-248 °C |
| Boiling point: | 430.7±45.0 °C(Predicted) |
| Density | 1.482 |
| storage temp. | 2-8°C |
| pka | 16.31±0.20(Predicted) |
| Appearance | Light yellow to brown Solid |
| InChI | InChI=1S/C7H8N2O2/c10-7(11)6-4-2-1-3-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11) |
| InChIKey | FCYBBDFUBSEGMX-UHFFFAOYSA-N |
| SMILES | N1=C(C(O)=O)C2CCCC=2N1 |
Description and Uses
1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic Acid is used in the synthetic preparation of pyrazole derivatives as partial agonists for nicotinic acid receptor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |

![1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/5932-32-1.gif)



![1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide](https://img.chemicalbook.com/CAS/GIF/299166-55-5.gif)