PRODUCT Properties
| Melting point: | 158-159℃ |
| Boiling point: | 339℃ |
| Density | 1.514 |
| Flash point: | 159℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 0.88±0.10(Predicted) |
| color | White to Orange to Green |
| λmax | 306nm(Cyclohexane)(lit.) |
| InChI | InChI=1S/C13H8BrNO/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H |
| InChIKey | RBVHJNZMSBQFDK-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2N=C1C1=CC=C(Br)C=C1 |
Description and Uses
2-(4-Bromo-Phenyl)-Benzooxazole (cas# 3164-13-4) is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2934.99.4400 |

![2-(4-Bromophenyl)benzo[d]oxazole](https://img.chemicalbook.com/CAS/GIF/3164-13-4.gif)



![2-(4-Bromo-3-methylphenyl)benzo[d]oxazol-5-amine](https://img.chemicalbook.com/CAS/GIF/354561-72-1.gif)