BD3460745
trans-4-Amino-1-methylcyclohexanol , 98% , 177908-37-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB360.00 | In Stock |
|
| 250mg | RMB663.20 | In Stock |
|
| 1g | RMB1657.60 | In Stock |
|
| 5g | RMB5801.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 203℃ |
| Density | 0.998 |
| Flash point: | 77℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 15.19±0.40(Predicted) |
| Appearance | white to off-white solid |
| InChI | InChI=1S/C7H15NO/c1-7(9)4-2-6(8)3-5-7/h6,9H,2-5,8H2,1H3/t6-,7- |
| InChIKey | KUKASNZJTIKRMH-LJGSYFOKSA-N |
| SMILES | [C@]1(C)(O)CC[C@@H](N)CC1 |
Description and Uses
trans-4-Amino-1-methylcyclohexanol was used to design, synthesize and perform biological evaluation of substituted benzoxazoles as inhibitors of mPGES-1.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P261 |
| HS Code | 2922190090 |
