BD3522245
(4-Methoxy-3,5-dimethylpyridin-2-yl)methylacetate , 95% , 91219-90-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB565.60 | In Stock |
|
| 1g | RMB1420.80 | In Stock |
|
| 5g | RMB3699.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45.5-49.5 °C(lit.) |
| Boiling point: | 293.2±35.0 °C(Predicted) |
| Density | 1.089±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 5.72±0.47(Predicted) |
| InChI | InChI=1S/C11H15NO3/c1-7-5-12-10(6-15-9(3)13)8(2)11(7)14-4/h5H,6H2,1-4H3 |
| InChIKey | OKIMSBLHXKXTTE-UHFFFAOYSA-N |
| SMILES | C1(COC(=O)C)N=CC(C)=C(OC)C=1C |
Description and Uses
Des-ethylsulfinyl-methoxybenzoimidazole 2-Acetyloxy Esomeprazole is an impurity of Esomeprazole Magnesium (E668300), an S-Form of Omeprazole (O635000). Gastric proton-pump inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
