BD3546948
1,2-Di(1H-imidazol-1-yl)ethane-1,2-dione , 98% , 18637-83-7
Synonym(s):
Oxalic acid diimidazolide
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1g | RMB212.80 | In Stock |
|
| 5g | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C(lit.) |
| Boiling point: | 441.4±28.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| form | Powder |
| pka | 1.92±0.10(Predicted) |
| color | Yellow to brown |
| BRN | 611833 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H6N4O2/c13-7(11-3-1-9-5-11)8(14)12-4-2-10-6-12/h1-6H |
| InChIKey | ONRNRVLJHFFBJG-UHFFFAOYSA-N |
| SMILES | C(N1C=NC=C1)(=O)C(N1C=NC=C1)=O |
| CAS DataBase Reference | 18637-83-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2933.29.9000 |
| HazardClass | 8 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







