BD3549441
3-(Phenylsulfonyl)propanoicacid , 97% , 10154-71-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB165.60 | In Stock |
|
| 10g | RMB245.60 | In Stock |
|
| 25g | RMB601.60 | In Stock |
|
| 100g | RMB1554.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C (lit.) |
| Boiling point: | 458.9±37.0 °C(Predicted) |
| Density | 1.348±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: soluble25mg/mL, clear, colorless |
| form | solid |
| pka | 3.85±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H10O4S/c10-9(11)6-7-14(12,13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) |
| InChIKey | WGTYYNCSWCKXAI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCS(C1=CC=CC=C1)(=O)=O |
Description and Uses
3-(Phenylsulfonyl)propionic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
