BD3549945
(3-Methyl-4-nitrophenyl)methanol , 98% , 80866-75-7
CAS NO.:80866-75-7
Empirical Formula: C8H9NO3
Molecular Weight: 167.16
MDL number: MFCD00007171
EINECS: 279-578-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB87.20 | In Stock |
|
| 5g | RMB278.40 | In Stock |
|
| 25g | RMB786.40 | In Stock |
|
| 100g | RMB2688.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-58 °C(lit.) |
| Boiling point: | 295.73°C (rough estimate) |
| Density | 1.2917 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 13.62±0.10(Predicted) |
| form | powder |
| color | yellow-orange |
| BRN | 2363298 |
| InChI | 1S/C8H9NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10H,5H2,1H3 |
| InChIKey | KOVQGYQQVNCUBR-UHFFFAOYSA-N |
| SMILES | Cc1cc(CO)ccc1[N+]([O-])=O |
Description and Uses
3-Methyl-4-nitrobenzyl alcohol was used as starting reagent in the synthesis of 3-methyl-4-iodophenylalanine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |






