BD3553345
(S)-3-Hydroxy-4-(trimethylammonio)butanoate , 98% , 541-14-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB172.00 | In Stock |
|
| 250mg | RMB257.60 | In Stock |
|
| 1g | RMB628.80 | In Stock |
|
| 5g | RMB2068.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197 °C |
| alpha | D +30.9° |
| Boiling point: | 287.5°C (rough estimate) |
| Density | 1.1587 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 13,1862 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/s3 |
| InChIKey | PHIQHXFUZVPYII-ISZMHOAENA-N |
| SMILES | C([C@@H](O)CC(=O)[O-])[N+](C)(C)C |&1:1,r| |
Description and Uses
Essential cofactor of fatty acid metabolism; required for the transport of fatty acids through the inner mitochondrial membrane. Synthetized primarily in the liver and kidney; highest concentrations found in heart and skeletal muscle. Dietary sources include red meat, dairy products, beans, avocado.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | BP2979850 |
| HazardClass | IRRITANT |
| HS Code | 29391900 |
