BD3568945
2-(4-Aminophenyl)butanoicacid , 95% , 29644-97-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB168.80 | In Stock |
|
| 250mg | RMB337.60 | In Stock |
|
| 1g | RMB844.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-143℃ |
| Boiling point: | 354.6±17.0 °C(Predicted) |
| Density | 1.171±0.06 g/cm3 (20 ºC 760 Torr) |
| vapor pressure | 13-18hPa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.01±0.10(Predicted) |
| form | Solid:particulate/powder |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H13NO2/c1-2-9(10(12)13)7-3-5-8(11)6-4-7/h3-6,9H,2,11H2,1H3,(H,12,13) |
| InChIKey | WAPLXGPARWRGJO-UHFFFAOYSA-N |
| SMILES | C1(C=CC(N)=CC=1)C(CC)C(=O)O |
| LogP | -1.3 at 19.8℃ and pH7 |
| Surface tension | 75.21mN/m at 1g/L and 20℃ |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Toxicity | mouse,LD50,intraperitoneal,1180mg/kg (1180mg/kg),Farmaco, Edizione Scientifica. Vol. 13, Pg. 286, 1958. |






![2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid](https://img.chemicalbook.com/CAS/GIF/94232-67-4.gif)