![2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid](https://img.chemicalbook.com/CAS/GIF/94232-67-4.gif)
LN-277734
2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid , 0.95 , 94232-67-4
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 527.9±52.0 °C(Predicted) |
| Density | 1.39[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| pka | 4.39±0.10(Predicted) |
| Water Solubility | 7.72mg/L at 20℃ |
| InChI | InChI=1S/C18H15NO4/c1-2-13(18(22)23)11-7-9-12(10-8-11)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-10,13H,2H2,1H3,(H,22,23) |
| InChIKey | ZQKLRJAOOUMVSA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C1=CC=C(N2C(=O)C3=C(C2=O)C=CC=C3)C=C1)CC |
| LogP | 2.3 |
Description and Uses
Indobufen 1,?3-?Dioxo is a derivative of Indobufen(I576500) which is a platelet aggregation inhibitor. Indobufen is the anticoagulant drug and platelet aggregation inhibitor, which has anti-inflammatory analgesic effect. Indobufen is used as an antithrombotic.
