BD3570541
(S)-1-Benzyl2-methylaziridine-1,2-dicarboxylate , 95% , 104597-98-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB228.80 | In Stock |
|
| 1g | RMB564.80 | In Stock |
|
| 5g | RMB1979.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160-165 °C/2 mmHg (lit.) |
| Density | 1.19 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 110 °C |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Soluble), Dichloromethane |
| pka | -5.65±0.40(Predicted) |
| form | Oil |
| color | Colourless |
| optical activity | [α]20/D 25°, c = 1 in toluene |
| InChI | InChI=1S/C12H13NO4/c1-16-11(14)10-7-13(10)12(15)17-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,13/m0/s1 |
| InChIKey | GTZJUBQWCWZING-NKUHCKNESA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H]1C(OC)=O |
Description and Uses
Methyl (S)-(–)-N-Z-aziridine-2-carboxylate is a chiral building block that is commonly used in the organic stereoselective synthesis of various compounds, including anticancer agents, antibiotics, and enzyme inhibitors.
Like aziridine carboxylic acid ester derivative, (S)-1-Benzyl 2-methyl aziridine-1,2-dicarboxylate can be used for the synthetic application of chiral aziridine via esterification.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |





