BD3574641
4-(Piperidin-1-yl)benzaldehyde , 98% , 10338-57-5
Synonym(s):
1-(4-Formylphenyl)piperidine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB268.00 | In Stock |
|
| 25g | RMB1076.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C |
| Boiling point: | 344.3±25.0 °C(Predicted) |
| Density | 1.091±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 3.88±0.20(Predicted) |
| color | Yellow |
| InChI | 1S/C12H15NO/c14-10-11-4-6-12(7-5-11)13-8-2-1-3-9-13/h4-7,10H,1-3,8-9H2 |
| InChIKey | ILJVPSVCFVQUAD-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)N2CCCCC2 |
| CAS DataBase Reference | 10338-57-5(CAS DataBase Reference) |
Description and Uses
Reactant for synthesis of:
- Anti-inflammatory agents
- Piperidine incorporated α-aminophosphonates for antibacterial agents
- 5-Hydroxyaurone derivatives as growth inhibitors against HUVEC and some cancer cell lines
- NR2B selective NMDA receptor antagonists
- Fulleropyrrolidines
- Fluorophores for monitoring polymerization processes
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






