BD3575441
1-(3-Fluoro-4-methoxyphenyl)ethanamine , 95+% , 105321-49-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB546.40 | In Stock |
|
| 250mg | RMB894.40 | In Stock |
|
| 1g | RMB1893.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244.3±30.0 °C(Predicted) |
| Density | 1.092±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 8.97±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H12FNO/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-6H,11H2,1-2H3 |
| InChIKey | WGUPBBABCUKYCC-UHFFFAOYSA-N |
| SMILES | C1(F)C(OC)=CC=C(C(C)N)C=1 |
Description and Uses
1-(3-Fluoro-4-methoxyphenyl)ethanamine is a useful compound in preparation of heteroaryl-fused pyridines as orexin receptor inhibitors.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2735 |
| HazardClass | IRRITANT |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
