BD3575845
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(furan-2-yl)propanoicacid , 98% , 220497-85-8
Synonym(s):
(R)-2-(Fmoc-amino)-3-(2-furyl)propionicacid;Fmoc-3-(2-furyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB71.20 | In Stock |
|
| 250mg | RMB145.60 | In Stock |
|
| 1g | RMB444.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121.6 °C |
| Boiling point: | 505.72°C (rough estimate) |
| Density | 1.318±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5614 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.62±0.10(Predicted) |
| form | Powder |
| color | White to light yellow |
| optical activity | 38.8°(C=0.01g/mL, DMF, 20°C, 589nm) |
| Major Application | peptide synthesis |
| InChI | 1S/C22H19NO5/c24-21(25)20(12-14-6-5-11-27-14)23-22(26)28-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-11,19-20H,12-13H2,(H,23,26)(H,24,25)/t20-/m1/s1 |
| InChIKey | AJXDCHXGNUFBRC-HXUWFJFHSA-N |
| SMILES | OC(=O)[C@@H](Cc1ccco1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 220497-85-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29321900 |
| Storage Class | 13 - Non Combustible Solids |







