BD3587345
8-Fluoroquinoline-3-carboxylicacid , 95% , 71082-53-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB68.80 | In Stock |
|
| 250mg | RMB111.20 | In Stock |
|
| 1g | RMB284.80 | In Stock |
|
| 5g | RMB1028.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 352.1±27.0 °C(Predicted) |
| Density | 1.431±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.28±0.30(Predicted) |
| form | powder |
| color | Off-white |
| InChI | 1S/C10H6FNO2/c11-8-3-1-2-6-4-7(10(13)14)5-12-9(6)8/h1-5H,(H,13,14) |
| InChIKey | QKUIXNPZATTWNU-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=CC2=CC=CC(F)=C2N=C1 |
Description and Uses
8-Fluoro-3-quinolinecarboxylic Acid is used as a reactant in the synthesis of an inhibitor of proteasome subunit Rpn11.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |



![8-Fluoroimidazo[1,2-a]pyridine-3-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/1019021-92-1.gif)
![Ethyl8-fluoroimidazo[1,2-a]pyridine-2-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/1260843-88-6.gif)
![8-Fluoroimidazo[1,2-a]pyridine](https://img.chemicalbook.com/CAS/GIF/139022-26-7.gif)

