BD8750231
8-Fluoroquinoline , 97% , 394-68-3
CAS NO.：394-68-3
Empirical Formula: C9H6FN
Molecular Weight: 147.15
MDL number: MFCD01685514
EINECS: 807-825-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB60.80 | In Stock |
|
| 10g | RMB116.00 | In Stock |
|
| 25g | RMB255.20 | In Stock |
|
| 100g | RMB976.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 148 °C(Press: 30 Torr) |
| Density | 1.215 g/cm3(Temp: 25 °C) |
| refractive index | 1.60 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 1.93±0.17(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C9H6FN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChIKey | RNAAXKYOTPSFGV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2F)C=CC=1 |
| CAS DataBase Reference | 394-68-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P312 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HS Code | 2933499090 |
