BD3594241
su-5614 , 96% , 1055412-47-9
Synonym(s):
(3Z)-5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one
CAS NO.:1055412-47-9
Empirical Formula: C15H13ClN2O
Molecular Weight: 272.73
MDL number: MFCD01868565
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB460.00 | In Stock |
|
| 250mg | RMB1048.80 | In Stock |
|
| 1g | RMB2645.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 508.6±50.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: ≥20mg/mL |
| pka | 11.96±0.20(Predicted) |
| form | powder |
| color | orange |
| InChI | 1S/C15H13ClN2O/c1-8-5-9(2)17-14(8)7-12-11-6-10(16)3-4-13(11)18-15(12)19/h3-7,17H,1-2H3,(H,18,19)/b12-7- |
| InChIKey | XLBQNZICMYZIQT-GHXNOFRVSA-N |
| SMILES | Cc1cc(C)c(\C=C2/C(=O)Nc3ccc(Cl)cc23)[nH]1 |
Description and Uses
SU5614 is a FMS-like tyrosine kinase 3 (FLT3) inhibitor; selective inhibitor of VEGF and PDGF receptor tyrosine kinases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413 |
| Precautionary statements | P264-P270-P273-P301+P312-P330 |
| Risk Statements | 53 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |







