BD3610748
1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine , 97% , 74852-61-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB190.40 | In Stock |
|
| 250mg | RMB316.80 | In Stock |
|
| 1g | RMB853.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-190 °C |
| Boiling point: | 515.7±50.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.17±0.40(Predicted) |
| color | Yellow to Dark Brown |
| Water Solubility | 36.9μg/L at 20℃ |
| InChI | InChI=1S/C17H19N3O3/c1-23-17-8-6-15(7-9-17)19-12-10-18(11-13-19)14-2-4-16(5-3-14)20(21)22/h2-9H,10-13H2,1H3 |
| InChIKey | AVCKOFMRPAJEPN-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(OC)C=C2)CCN(C2=CC=C([N+]([O-])=O)C=C2)CC1 |
| LogP | 3.4 at 20℃ |
| CAS DataBase Reference | 74852-61-2(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of angiogenesis inhibitors
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340 |
