BD3616441
4'-Methyl-[2,2'-bipyridine]-4-carboxylicacid , 97% , 103946-54-9
CAS NO.:103946-54-9
Empirical Formula: C12H10N2O2
Molecular Weight: 214.22
MDL number: MFCD11112059
EINECS: 145-896-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB259.20 | In Stock |
|
| 250mg | RMB630.40 | In Stock |
|
| 1g | RMB1361.60 | In Stock |
|
| 5g | RMB4952.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280 °C |
| Boiling point: | 497.4±45.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.66±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C12H10N2O2/c1-8-2-4-13-10(6-8)11-7-9(12(15)16)3-5-14-11/h2-7H,1H3,(H,15,16) |
| InChIKey | LEJWPWXRHHUDRH-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C)=C2)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 103946-54-9(CAS DataBase Reference) |
Description and Uses
4''-Methyl-2,2''-bipyridine-4-carboxylic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |

![4'-Methyl-[2,2'-bipyridine]-4-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/103946-54-9.gif)





![Dibutyl[2,2'-bipyridine]-4,4'-dicarboxylate](https://img.chemicalbook.com/CAS/GIF/69641-93-6.gif)