BD3619341
5-Hydroxypentan-2-one , 92%(mixtureofmonomeranddimer) , 1071-73-4
Synonym(s):
3-Acetyl-1-propanol
CAS NO.:1071-73-4
Empirical Formula: C5H10O2
Molecular Weight: 102.13
MDL number: MFCD00002961
EINECS: 213-994-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB24.00 | In Stock |
|
| 25g | RMB32.00 | In Stock |
|
| 100g | RMB103.20 | In Stock |
|
| 500g | RMB380.80 | In Stock |
|
| 1000g | RMB571.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2.5°C (estimate) |
| Boiling point: | 144-145 °C/100 mmHg (lit.) |
| Density | 1.007 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | 2-8°C |
| pka | 14.89±0.10(Predicted) |
| form | Liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C5H10O2/c1-5(7)3-2-4-6/h6H,2-4H2,1H3 |
| InChIKey | JSHPTIGHEWEXRW-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCO |
| LogP | -0.570 (est) |
| CAS DataBase Reference | 1071-73-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pentanone, 5-hydroxy-(1071-73-4) |
Description and Uses
3-Acetopropanol is a substrate for alcohol dehydrogenase and is an intermediate in the synthesis of Didesethyl Chloroquine (D440960), a metabolite of Chloroquine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 2 |
| RTECS | UA4600000 |
| HS Code | 29144000 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 orl-rat: 6400 mg/k TNICS* 13,118,73 |






