BD3635345
H-Hyp(tBu)-OtBu.HCl , 95% , 367453-05-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB83.20 | In Stock |
|
| 5g | RMB333.60 | In Stock |
|
| 25g | RMB1321.60 | In Stock |
|
| 100g | RMB3349.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | -7.7159°(C=0.5129g/100ml MEOH) |
| InChI | 1S/C13H25NO3.ClH/c1-12(2,3)16-9-7-10(14-8-9)11(15)17-13(4,5)6;/h9-10,14H,7-8H2,1-6H3;1H/t9-,10+;/m1./s1 |
| InChIKey | SSNWMVRXDJPQAN-UXQCFNEQSA-N |
| SMILES | Cl.CC(C)(C)O[C@H]1CN[C@@H](C1)C(=O)OC(C)(C)C |
Description and Uses
H-Hyp(tbu)-otbu hcl
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
