BD3661645
1-Bromo-5-chloro-3-fluoro-2-iodobenzene , 97% , 201849-16-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.80 | In Stock |
|
| 5g | RMB185.60 | In Stock |
|
| 25g | RMB719.20 | In Stock |
|
| 100g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106～107℃ |
| Boiling point: | 272℃ |
| Density | 2.331 |
| Flash point: | 118℃ |
| storage temp. | 2-8°C(protect from light) |
| form | crystalline solid |
| color | Brown |
| InChI | InChI=1S/C6H2BrClFI/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| InChIKey | IKJUIUCZEXVZMB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(F)=C1I |
Description and Uses
1-Bromo-5-chloro-3-fluoro-2-iodobenzene is useful in the preparation of a plurality of organic compounds for organic electronic devices.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
