BD3673248
5,6-Dimethoxy-1H-indole-2-carboxylicacid , 95% , 88210-96-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB70.40 | In Stock |
|
| 250mg | RMB109.60 | In Stock |
|
| 1g | RMB284.00 | In Stock |
|
| 5g | RMB1022.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210°C (dec.) |
| Boiling point: | 456.2±40.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.48±0.30(Predicted) |
| form | powder |
| color | Yellow-brown |
| Water Solubility | Insoluble in water. |
| BRN | 202249 |
| InChI | 1S/C11H11NO4/c1-15-9-4-6-3-8(11(13)14)12-7(6)5-10(9)16-2/h3-5,12H,1-2H3,(H,13,14) |
| InChIKey | UZHQHNDRVITJPL-UHFFFAOYSA-N |
| SMILES | COc1cc2cc([nH]c2cc1OC)C(O)=O |
| CAS DataBase Reference | 88210-96-2(CAS DataBase Reference) |
Description and Uses
5,6-Dimethoxyindole-2-carboxylic acid is used as a reagent and heterocyclic building blocks in synthetic chemistry. It is used to prepare a melanin-like polymer, poly(5,6-dimethoxyindole-2-carboxylic acid), which exhibits electrochromic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |







