PRODUCT Properties
| Melting point: | 230-232(dec.) |
| storage temp. | -20°C |
| solubility | DMSO, Methanol, Clear Yellow Solution in Pyridine @ 50mg/ml. |
| form | powder |
| color | tan |
| InChI | InChI=1S/C17H15NO4/c1-21-15-8-12-7-14(17(19)20)18-13(12)9-16(15)22-10-11-5-3-2-4-6-11/h2-9,18H,10H2,1H3,(H,19,20) |
| InChIKey | JMOOGCFXFNKYCS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C(OCC3=CC=CC=C3)=C2)C=C1C(O)=O |
| CAS DataBase Reference | 2495-92-3 |
Description and Uses
- Reactant for preparation of indolecarboxamides with antitumor activity in human lung cancer
- Reactant for preparation of benzophenone- and indolecarboxylic acids as potent type-2 specific inhibitors of human steroid 5α-reductase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |






