5,11-Dimethyl-6H-pyrido[4,3-b]carbazole , 98% , 519-23-3
Synonym(s):
5,11-Dimethyl-6H-pyrido[4,3-b]carbazole;Ellipticine - CAS 519-23-3 - Calbiochem
CAS NO.:519-23-3
Empirical Formula: C17H14N2
Molecular Weight: 246.31
MDL number: MFCD00010524
EINECS: 208-264-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB245.60 | In Stock |
|
| 10mg | RMB392.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 316-318°C |
| Boiling point: | 379.31°C (rough estimate) |
| Density | 1.257±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5794 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO: soluble |
| form | Bright yellow solid |
| pka | 16.59±0.40(Predicted) |
| color | Light yellow to yellow |
| Merck | 13,3581 |
| InChI | 1S/C17H14N2/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17/h3-9,19H,1-2H3 |
| InChIKey | CTSPAMFJBXKSOY-UHFFFAOYSA-N |
| SMILES | [nH]1c2c(c4c1cccc4)c(c3c(c2C)ccnc3)C |
| LogP | 4.800 |
| CAS DataBase Reference | 519-23-3(CAS DataBase Reference) |
Description and Uses
Ellipticine is an alkaloid isolated from Apocyanaceae plants that exhibits antitumor activities by intercalating into DNA and/or inhibiting DNA topoisomerase II. It forms covalent adducts in DNA after being enzymatically activated with cytochrome P450 isoforms (e.g., CYP3A4, CYP1A1, or CYP1A2) or by peroxidases in target tissues. Ellipticine has been shown to inhibit the proliferation of human breast adenocarcinoma MCF-7 cells, leukemia HL-60 and CCRF-CEM cells, neuroblastoma IMR-32, UKF-NB-3, and UKF-NB-4 cells, and U87MG glioblastoma cells with IC50 values ranging from 0.27-4.7 μM.
Ellipticine is a DNA intercalating agent and exhibits antitumor activities.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 3462 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UU8825000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 in mice (mg/kg): 19.5-22.4 i.v.; 178-204 orally (Rakieten) |

![5,11-Dimethyl-6H-pyrido[4,3-b]carbazole](https://img.chemicalbook.com/CAS/GIF/519-23-3.gif)

![N,N-diethyl-N'-(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)propane-1,3-diamine](https://img.chemicalbook.com/CAS/GIF/72238-02-9.gif)
![9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole](https://img.chemicalbook.com/CAS/GIF/10371-86-5.gif)
![5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol](https://img.chemicalbook.com/CAS/GIF/51131-85-2.gif)