BD3769348
1,3,4,6-Tetramethyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione , 95+% , 10095-06-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226 - 229C |
| Boiling point: | 362.2±42.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -0.49±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H14N4O2/c1-9-5-6(11(3)7(9)13)12(4)8(14)10(5)2/h5-6H,1-4H3 |
| InChIKey | XIUUSFJTJXFNGH-UHFFFAOYSA-N |
| SMILES | CN1C(N(C2N(C(N(C21)C)=O)C)C)=O |
Description and Uses
Temgicoluril (Tetramethylglycoluril) is an orally active antianxiety and antidepressant. Temgicoluril acts on GABA receptors to enhance GABA neurotransmission[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| HazardClass | IRRITANT |

![1,3,4,6-Tetramethyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione](https://img.chemicalbook.com/CAS/GIF/10095-06-4.gif)


![1,3,4,6-Tetrakis(butoxymethyl)tetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione](https://img.chemicalbook.com/CAS/GIF/15968-37-3.gif)
![Cucurbit[6]uril hydrate](https://img.chemicalbook.com/CAS/GIF/80262-44-8.gif)