BD3841248
(S)-6-Amino-2-((S)-2-((R)-2-amino-3-methylbutanamido)-4-methylpentanamido)-N-(4-nitrophenyl)hexanamidedihydrochloride , 95+% , 62354-43-2
Synonym(s):
D -Val-Leu-Lys p-nitroanilide;D -Val-Leu-Lys-pNA dihydrochloride;D -Valyl-L -leucyl-L -lysine 4-nitroanilide dihydrochloride
CAS NO.:62354-43-2
Empirical Formula: C23H40Cl2N6O5
Molecular Weight: 551.51
MDL number: MFCD00077899
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Water: soluble |
| form | A solid |
| color | White to off-white |
| Water Solubility | water: 50mg/mL, clear, light yellow |
| Sequence | {d-Val}-Leu-Lys-{pNA} |
| InChIKey | VESQMNNSPPEOSZ-RCCKPMNGNA-N |
| SMILES | C1(=CC=C([N+]([O-])=O)C=C1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](N)C(C)C.Cl.Cl |&1:12,21,29,r| |
Description and Uses
D-Val-Leu-Lys 4-nitroanilide dihydrochloride has been used as a chromogenic substrate to determine the formation of plasmin from plasminogen in amidolytic activity assay and plasminogen activating assay.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H361 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-63 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |







