BD3857146
(S)-N-(4-Nitrophenyl)-5-oxopyrrolidine-2-carboxamide , 97% , 66642-35-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB216.80 | In Stock |
|
| 250mg | RMB337.60 | In Stock |
|
| 1g | RMB761.60 | In Stock |
|
| 5g | RMB2656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 50mg/mL, clear, colorless to faintly yellow |
| form | powder |
| InChI | InChI=1S/C11H11N3O4/c15-10-6-5-9(13-10)11(16)12-7-1-3-8(4-2-7)14(17)18/h1-4,9H,5-6H2,(H,12,16)(H,13,15)/t9-/m0/s1 |
| InChIKey | HGNBEWLBSCSJGV-VIFPVBQESA-N |
| SMILES | N1C(=O)CC[C@H]1C(NC1=CC=C([N+]([O-])=O)C=C1)=O |
Description and Uses
Substrate for pyrrolidonylpeptidase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |






