BD3869948
4-Hydroxy-3-nitro-2H-chromen-2-one , 98+% , 20261-31-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172 °C (dec.) (lit.) |
| Boiling point: | 364.5±42.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | powder to crystal |
| pka | 4.50±1.00(Predicted) |
| color | White to Yellow to Green |
| λmax | 329nm(EtOH(50vol%))(lit.) |
| BRN | 1247343 |
| InChI | 1S/C9H5NO5/c11-8-5-3-1-2-4-6(5)15-9(12)7(8)10(13)14/h1-4,11H |
| InChIKey | NZQAQAUWFHMVEM-UHFFFAOYSA-N |
| SMILES | OC1=C(C(=O)Oc2ccccc12)[N+]([O-])=O |
| CAS DataBase Reference | 20261-31-8(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-3-nitrocoumarin may be used as starting reagent for the synthesis of following compounds:
- 4-chloro-3-nitrocoumarin
- 2-unsubstituted 3-nitrochromone
- 4-amino-3-nitrocoumarins
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2932.20.4500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |



