BD3871246
5-Amino-2-pyridinecarbonitrile , 96% , 55338-73-3
Synonym(s):
5-Amino-2-cyanopyridine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB105.60 | In Stock |
|
| 250mg | RMB155.20 | In Stock |
|
| 1g | RMB315.20 | In Stock |
|
| 5g | RMB918.40 | In Stock |
|
| 25g | RMB3236.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-152 °C(lit.) |
| Boiling point: | 368.2±27.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 0.61±0.10(Predicted) |
| Appearance | Light yellow to brown Solid |
| InChI | InChI=1S/C6H5N3/c7-3-6-2-1-5(8)4-9-6/h1-2,4H,8H2 |
| InChIKey | IFOXWHQFTSCNQB-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(N)C=C1 |
| CAS DataBase Reference | 55338-73-3(CAS DataBase Reference) |
Description and Uses
5-Amino-2-pyridinecarbonitrile (5-Amino-2-cyanopyridine) may be used to synthesize 5-amino-2-pyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







