BD3873448
Sodium2-oxo-3-phenylpropanoate , 98% , 114-76-1
Synonym(s):
2-Oxo-3-phenylpropanoic acid;Phenylpyruvic acid sodium salt
CAS NO.：114-76-1
Empirical Formula: C9H7NaO3
Molecular Weight: 186.14
MDL number: MFCD00002590
EINECS: 204-053-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1520.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| storage temp. | 2-8°C |
| form | powder |
| color | white |
| Water Solubility | Soluble in water |
| JECFA Number | 1479 |
| BRN | 4770978 |
| InChI | InChI=1S/C9H8O3.Na.H/c10-8(9(11)12)6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H,11,12);; |
| InChIKey | BMSDVJSGHPUSHZ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)C(=O)C(=O)O.[NaH] |
| LogP | 0.54 |
| CAS DataBase Reference | 114-76-1(CAS DataBase Reference) |
Description and Uses
Phenylpyruvic acid, sodium salt is a substrate for phenylpyruvate decarboxylase and phenylpyruvate tautomerase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 2918300090 |
