BD3898946
N,N'-(Hexane-1,6-diyl)diacetamide , 95% , 3073-59-4
Synonym(s):
N,N′-Diacetyl-1,6-hexanediamine;HMBA
CAS NO.:3073-59-4
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD00008684
EINECS: 211-363-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB103.20 | In Stock |
|
| 25g | RMB394.40 | In Stock |
|
| 100g | RMB1416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-129 °C(lit.) |
| Boiling point: | 338.01°C (rough estimate) |
| Density | 0.974 |
| refractive index | 1.4710 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: soluble5%, clear, colorless |
| pka | 16.20±0.46(Predicted) |
| form | A solid |
| color | White to off-white |
| Water Solubility | water: soluble 5%, clear, colorless |
| BRN | 1775764 |
| InChI | InChI=1S/C10H20N2O2/c1-9(13)11-7-5-3-4-6-8-12-10(2)14/h3-8H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | BNQSTAOJRULKNX-UHFFFAOYSA-N |
| SMILES | C(NC(=O)C)CCCCCNC(=O)C |
| CAS DataBase Reference | 3073-59-4(CAS DataBase Reference) |
Description and Uses
N,N′-Hexamethylene bis(acetamide) was used as an inducing agent in obtaining mononuclear cells from the peripheral blood (PB) sample by Ficoll-Hypaque gradient separation.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 33 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | AC2976200 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | human,TDLo,intravenous,4270mg/kg/10D (4270mg/kg),GASTROINTESTINAL: NAUSEA OR VOMITINGBLOOD: THROMBOCYTOPENIA,Cancer Research. Vol. 47, Pg. 5788, 1987. |





