BD3916646
3-Methoxy-2-nitrobenzaldehyde , 97% , 53055-05-3
CAS NO.:53055-05-3
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007135
EINECS: 258-332-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB150.40 | In Stock |
|
| 1g | RMB429.60 | In Stock |
|
| 5g | RMB1501.60 | In Stock |
|
| 10g | RMB2702.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-101 °C (lit.) |
| Boiling point: | 344.2±27.0 °C(Predicted) |
| Density | 1.322±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | White to beige or yellow |
| BRN | 1959385 |
| InChI | 1S/C8H7NO4/c1-13-7-4-2-3-6(5-10)8(7)9(11)12/h2-5H,1H3 |
| InChIKey | GDTUACILWWLIJF-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cccc(OC)c1[N+]([O-])=O |
| CAS DataBase Reference | 53055-05-3(CAS DataBase Reference) |
Description and Uses
3-Methoxy-2-nitrobenzaldehyde was used in the synthesis of 8-hydroxyquinazoline, methy-3-methoxyanthranilate and 3-methoxy-2-nitrobenzylidenebisformamide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |






