BD3949046
1,2-Bis((2S,5S)-2,5-diethylphospholan-1-yl)benzene , 98%99%ee , 136779-28-7
Synonym(s):
(S,S)-Ethyl-DUPHOS;(2S,2′S,5S,5′S)-2,2′,5,5′-Tetraethyl-1,1′-(o-phenylene)diphospholane
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB533.60 | In Stock |
|
| 250mg | RMB993.60 | In Stock |
|
| 1g | RMB2384.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | +265° (c 1, hexane) |
| Boiling point: | 468.5±15.0 °C(Predicted) |
| Density | 1.010 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Colorless to light yellow Viscous Liquid |
| optical activity | 146.34°(C=1.00g/100mL, hexane, 20°C, 589nm) |
| Sensitive | Air Sensitive |
| BRN | 4814174 |
| InChI | 1S/C22H36P2/c1-5-17-13-14-18(6-2)23(17)21-11-9-10-12-22(21)24-19(7-3)15-16-20(24)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m0/s1 |
| InChIKey | GVVCHDNSTMEUCS-MUGJNUQGSA-N |
| SMILES | CC[C@H]1CC[C@H](CC)P1c2ccccc2P3[C@@H](CC)CC[C@@H]3CC |
Description and Uses
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 1-10 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
