BD4201546
2,2-Difluoroethyl4-methylbenzenesulfonate , 97% , 135206-84-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB82.40 | In Stock |
|
| 250mg | RMB126.40 | In Stock |
|
| 1g | RMB319.20 | In Stock |
|
| 5g | RMB660.80 | In Stock |
|
| 25g | RMB2877.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 335.0±32.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear |
| InChI | InChI=1S/C9H10F2O3S/c1-7-2-4-8(5-3-7)15(12,13)14-6-9(10)11/h2-5,9H,6H2,1H3 |
| InChIKey | ZUBSOOAAXYCXMN-UHFFFAOYSA-N |
| SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)C(F)F |
Description and Uses
2,2-Difluoroethyl P-Toluenesulfonate is a reagent used in the preparation of (difluorophenyl)[(arylmethyl)thio](triazolyl)butanol fungicides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 10-20/21-38 |
| Safety Statements | 25 |
| RIDADR | UN 1307 3 / PGIII |
| HazardClass | IRRITANT |
| HS Code | 2904100090 |
