![N-((4S,6S)-6-Methyl-7,7-dioxido-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)acetamide](https://img.chemicalbook.com/CAS/GIF/147200-03-1.gif)
BD4544341
N-((4S,6S)-6-Methyl-7,7-dioxido-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)acetamide , 95% , 147200-03-1
CAS NO.：147200-03-1
Empirical Formula: C10H14N2O5S3
Molecular Weight: 338.42
MDL number: MFCD12407171
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB46.40 | In Stock |
|
| 250mg | RMB68.80 | In Stock |
|
| 1g | RMB172.80 | In Stock |
|
| 5g | RMB525.60 | In Stock |
|
| 10g | RMB878.40 | In Stock |
|
| 25g | RMB1671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.62 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Sonicated) |
| pka | 9.38±0.60(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C10H14N2O5S3/c1-5-3-8(12-6(2)13)7-4-9(20(11,16)17)18-10(7)19(5,14)15/h4-5,8H,3H2,1-2H3,(H,12,13)(H2,11,16,17)/t5-,8-/m0/s1 |
| InChIKey | MQRCTNZVQVRCRD-XNCJUZBTSA-N |
| SMILES | C(N[C@H]1C[C@H](C)S(=O)(=O)C2SC(S(N)(=O)=O)=CC=21)(=O)C |
Description and Uses
N-[(4S,6S)-2-(Aminosulfonyl)-5,6-dihydro-6-methyl-7,7-dioxido-4H-thieno[2,3-b]thiopyran-4-yl]acetamide is used as a reagent in the synthesis of MK-0507, a topically-active carbonic anhydrase inhibitor.
Safety
| Symbol(GHS) |   GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H304-H402-H226 |
| Precautionary statements | P501-P273-P240-P210-P233-P243-P241-P242-P280-P370+P378-P331-P303+P361+P353-P301+P310-P403+P235-P405 |
