BD4550841
Cis-cyclooctane-1,2-diol , 97% , 27607-33-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB148.80 | In Stock |
|
| 5g | RMB557.60 | In Stock |
|
| 25g | RMB2246.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 264.6±8.0 °C(Predicted) |
| Density | 1.061±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 14.52±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C8H16O2/c9-7-5-3-1-2-4-6-8(7)10/h7-10H,1-6H2/t7-,8+ |
| InChIKey | HUSOFJYAGDTKSK-OCAPTIKFNA-N |
| SMILES | [C@@H]1(O)CCCCCC[C@@H]1O |&1:0,8,r| |
Description and Uses
cis-1,2-Cyclooctanediol may be used in the preparation of suberic acid.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37-36/37/39 |
| WGK Germany | 3 |
