BD4666941
4,8-Dibromoquinoline , 97% , 1070879-31-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB59.20 | In Stock |
|
| 1g | RMB176.00 | In Stock |
|
| 5g | RMB696.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 339.4±22.0 °C(Predicted) |
| Density | 1.923 |
| storage temp. | 2-8°C |
| pka | 0.72±0.30(Predicted) |
| InChI | InChI=1S/C9H5Br2N/c10-7-4-5-12-9-6(7)2-1-3-8(9)11/h1-5H |
| InChIKey | LNJMYWNYBSIPIS-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2Br)C(Br)=CC=1 |
Description and Uses
4,8-Dibromoquinoline (4-BROMO-8-BROMOQUINOLINE) is a quinoline compound containing two bromine functional groups, which can be used as a luminescent molecule for the preparation of dual-emission materials.



