BD4675041
3-(4-Chlorophenyl)propan-1-ol , 95% , 6282-88-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB100.00 | In Stock |
|
| 5g | RMB277.60 | In Stock |
|
| 25g | RMB971.20 | In Stock |
|
| 100g | RMB3817.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 104°C 0,1mm |
| Density | 1.151±0.06 g/cm3(Predicted) |
| refractive index | 1.54 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 15.03±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C9H11ClO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7H2 |
| InChIKey | ZHBIWFGGIKFSHZ-UHFFFAOYSA-N |
| SMILES | C1(CCCO)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 6282-88-8(CAS DataBase Reference) |
Description and Uses
3-(4-Chlorophenyl)propan-1-ol is used in preparation of 2-Oxo-2H-chromene-3-carboxylic Acid Amide derivatives as Aldo-Keto reductase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/37/39-24/25-39 |
| HazardClass | IRRITANT |
| HS Code | 2906290090 |
