BD4737141
2-Chloro-5-fluorobenzonitrile , 98% , 57381-56-3
CAS NO.：57381-56-3
Empirical Formula: C7H3ClFN
Molecular Weight: 155.56
MDL number: MFCD03094168
EINECS: 260-714-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 10g | RMB212.00 | In Stock |
|
| 25g | RMB450.40 | In Stock |
|
| 100g | RMB1770.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65 °C |
| Boiling point: | 228.7±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C7H3ClFN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H |
| InChIKey | HBTXAKDVIXNVHZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(F)=CC=C1Cl |
| CAS DataBase Reference | 57381-56-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H311-H332-H301-H315-H319 |
| Precautionary statements | P280h-P305+P351+P338-P309-P310-P264-P270-P280-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 20/21/22-36/38 |
| Safety Statements | 26-36/37 |
| RIDADR | UN3439 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
