BD4744741
6-Methoxyquinoline-4-carboxylicacid , 98% , 86-68-0
CAS NO.：86-68-0
Empirical Formula: C11H9NO3
Molecular Weight: 203.19
MDL number: MFCD00024013
EINECS: 617-906-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB392.00 | In Stock |
|
| 250mg | RMB588.00 | In Stock |
|
| 1g | RMB1765.60 | In Stock |
|
| 5g | RMB4820.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280°C (decompose) |
| Boiling point: | 341.49°C (rough estimate) |
| Density | 1.2621 (rough estimate) |
| refractive index | 1.4950 (estimate) |
| storage temp. | 2-8°C |
| solubility | Solubility Slightly soluble in water, cold ethanol, ether |
| pka | 5.53(at 25℃) |
| form | crystals |
| color | Pale yellow |
| PH Range | Yellow I uorescent (4.0) to blue I uorescent (5.0) |
| Merck | 14,8062 |
| Major Application | Display device, antihypertensive food materials, nucleic acids, antimalarial agent, antimalerial agent |
| InChI | InChI=1S/C11H9NO3/c1-15-7-2-3-10-9(6-7)8(11(13)14)4-5-12-10/h2-6H,1H3,(H,13,14) |
| InChIKey | XXLFLUJXWKXUGS-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(OC)=CC=2)C(C(O)=O)=CC=1 |
| CAS DataBase Reference | 86-68-0 |
Description and Uses
6-methoxyquinoline-4-carboxylic Acid is used in the preparation of tetrahydroisoquinoline amides as multidrug resistance reversers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933.49.7000 |
