BD4772841
Fmoc-P-carboxy-Phe(OtBu)-OH , 98% , 183070-44-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB249.60 | In Stock |
|
| 250mg | RMB312.80 | In Stock |
|
| 1g | RMB746.40 | In Stock |
|
| 5g | RMB2267.20 | In Stock |
|
| 10g | RMB3656.00 | In Stock |
|
| 25g | RMB8893.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 684.6±55.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.67±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChIKey | GQIVAZYTLZQGHT-VWLOTQADSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(C(OC(C)(C)C)=O)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-p-carboxy-phe(OtBu)-OH is used in Fmoc-based solid-phase peptide synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P302+P352 |






