BD4800141
Lixivaptan , 95% , 168079-32-1
Synonym(s):
N-[3-Chloro-4-(5H-pyrrolo[2,1-c][1,4]benzodiazepine-10(11H)-ylcarbonyl)phenyl]-5-fluoro-2-methylbenzamide;VPA 985;WAY-VPA 985
CAS NO.：168079-32-1
Empirical Formula: C27H21ClFN3O2
Molecular Weight: 473.93
MDL number: MFCD00937905
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB524.80 | In Stock |
|
| 25mg | RMB891.20 | In Stock |
|
| 50mg | RMB1424.80 | In Stock |
|
| 100mg | RMB2279.20 | In Stock |
|
| 250mg | RMB3874.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >114°C (dec.) |
| Boiling point: | 626.5±55.0 °C(Predicted) |
| Density | 1.32 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: soluble20mg/mL, clear |
| form | powder |
| pka | 11.86±0.70(Predicted) |
| color | white to beige |
| InChI | InChI=1S/C27H21ClFN3O2/c1-17-8-9-19(29)13-23(17)26(33)30-20-10-11-22(24(28)14-20)27(34)32-16-21-6-4-12-31(21)15-18-5-2-3-7-25(18)32/h2-14H,15-16H2,1H3,(H,30,33) |
| InChIKey | PPHTXRNHTVLQED-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(C(N2C3=CC=CC=C3CN3C=CC=C3C2)=O)C(Cl)=C1)(=O)C1=CC(F)=CC=C1C |
Description and Uses
Lixivaptan is a drug used in the treatment and prevention of cardiovascular diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | 3 |
