BD4806941
PF-4708671 , 98% , 1255517-76-0
Synonym(s):
2-((4-(5-Ethylpyrimidin-4-yl)piperazin-1-yl)methyl)-5-(trifluoromethyl)-1H-benzo[d]imidazole
CAS NO.:1255517-76-0
Empirical Formula: C19H21F3N6
Molecular Weight: 390.41
MDL number: MFCD18086922
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB800.00 | In Stock |
|
| 100mg | RMB1200.00 | In Stock |
|
| 250mg | RMB1799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 572.8±50.0 °C(Predicted) |
| Density | 1.348±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 10.20±0.10(Predicted) |
| color | off-white |
| InChI | 1S/C19H21F3N6/c1-2-13-10-23-12-24-18(13)28-7-5-27(6-8-28)11-17-25-15-4-3-14(19(20,21)22)9-16(15)26-17/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,26) |
| InChIKey | FBLPQCAQRNSVHB-UHFFFAOYSA-N |
| SMILES | CCC(C=NC=N1)=C1N2CCN(CC3=NC4=C(C=CC(C(F)(F)F)=C4)N3)CC2 |
Description and Uses
PF-4708671 is a highly specific inhibitor of p70 ribosomal S6 kinase (S6K1). PF-4708671 inhibits S6K1-mediated phosphorylation of S6 protein in response to IGF-1 (insulin-like growth factor 1), while having no effect on highly related RSK (p90 ribosomal S6 kinase) and MSK (mitogen- and stress-activated kinase) kinases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |






