BD4866041
2-Phenylisoindole-1,3-dione , 95% , 520-03-6
CAS NO.:520-03-6
Empirical Formula: C14H9NO2
Molecular Weight: 223.23
MDL number: MFCD00023044
EINECS: 208-282-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB68.00 | In Stock |
|
| 5g | RMB236.80 | In Stock |
|
| 25g | RMB901.60 | In Stock |
|
| 100g | RMB3247.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-207 °C(lit.) |
| Boiling point: | 364.52°C (rough estimate) |
| Density | 1.1814 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | 2-8°C |
| pka | -0.54±0.20(Predicted) |
| form | powder |
| Appearance | White to off-white Solid |
| InChI | 1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H |
| InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| SMILES | O=C1N(c2ccccc2)C(=O)c3ccccc13 |
| CAS DataBase Reference | 520-03-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-phenyl- (520-03-6) |
Description and Uses
N-PHENYLPHTHALIMIDE is an intermediate of indoprofen.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | 3 |
| RTECS | TI5635800 |
| TSCA | TSCA listed |
| Storage Class | 13 - Non Combustible Solids |






